On Target NK1R_HUMAN 0.41/CHEMBL205829
For the given ligand ok, we have found in our database that, being scored 0.41, the most similar ligand is CHEMBL205829. Check out the elaboration below.
| ok (Given Ligand) | CHEMBL205829 (Similar Ligand) |
|---|---|
| COc4ccc(c3cc1nccn1c(Nc2ccccc2C(N)=O)n3)cc4OC | CN(Cc1cc(cc(c1)C(F)(F)F)C(F)(F)F)C(=O)c2cnc(nc2c3ccccc3C)N4CCN(C)CC4 |
|
|
|
|
|
|
| 0000a20a 40800808 a0080108 08850600 01001044 0001c000 0204a000 00081800 00c00100 00000840 01208004 60009800 8600c832 00100000 01060041 080c800c 08060040 12006000 0cc90008 10a23200 40000000 4c02a640 b1806840 0040010c 00000000 80000000 00028000 000110e0 0000c20c 00461808 c0041800 400000a2 | 1800a002 018a0801 80100180 14050610 01000005 0001c000 10006400 02081000 00400100 30000850 4020a004 6000c802 03008802 01302800 a0020d00 001c800c 00022000 02006000 04400000 40e00000 80020000 2e02ae00 30803860 02400108 00040000 c0000000 08004000 90000060 0800411c 00460801 c0141800 800002a0 |