On Target AOFB_HUMAN 0.37967914/CHEMBL2408565
For the given ligand ok, we have found in our database that, being scored 0.37967914, the most similar ligand is CHEMBL2408565. Check out the elaboration below.
| ok (Given Ligand) | CHEMBL2408565 (Similar Ligand) |
|---|---|
| COc4ccc(c3cc1nccn1c(Nc2ccccc2C(N)=O)n3)cc4OC | CC1CC(=O)c2cnc(Nc3ccc(C)cc3)nc2C1 |
|
|
|
|
|
|
| 0000a20a 40800808 a0080108 08850600 01001044 0001c000 0204a000 00081800 00c00100 00000840 01208004 60009800 8600c832 00100000 01060041 080c800c 08060040 12006000 0cc90008 10a23200 40000000 4c02a640 b1806840 0040010c 00000000 80000000 00028000 000110e0 0000c20c 00461808 c0041800 400000a2 | 00010002 01000800 00000182 40850610 05000104 0000c002 01002000 00000001 00400900 000c0840 20308004 4000b800 0c008000 00308800 00020960 000c0004 00040200 16004000 08402008 50a00001 c0500400 0c402240 24804840 00400118 00042000 80000201 00000000 00010080 0000800e 00460802 c0000000 20c000a2 |