On Target PRGR_HUMAN 0.35497835/CHEMBL3337731
For the given ligand ok, we have found in our database that, being scored 0.35497835, the most similar ligand is CHEMBL3337731. Check out the elaboration below.
| ok (Given Ligand) | CHEMBL3337731 (Similar Ligand) |
|---|---|
| COc4ccc(c3cc1nccn1c(Nc2ccccc2C(N)=O)n3)cc4OC | Cc1nn(Cc2ccccc2)c(c3ccc(F)cc3)c1c4ccc5OCC(=O)Nc5c4 |
|
|
|
|
|
|
| 0000a20a 40800808 a0080108 08850600 01001044 0001c000 0204a000 00081800 00c00100 00000840 01208004 60009800 8600c832 00100000 01060041 080c800c 08060040 12006000 0cc90008 10a23200 40000000 4c02a640 b1806840 0040010c 00000000 80000000 00028000 000110e0 0000c20c 00461808 c0041800 400000a2 | 04006006 40000209 e0101188 02010612 a58810c0 0000201a 02448001 00001000 80120000 000008d0 002c008c 6001c000 01809832 00b01000 21061841 800c640c 08060048 82c01000 0c480000 00321000 41100000 1805a600 33802801 8350c009 00054001 c0000000 38028248 100000e1 0540c304 00068009 00040200 00000222 |