On Target OPRD_HUMAN 0.3846154/CHEMBL212368
For the given ligand ok, we have found in our database that, being scored 0.3846154, the most similar ligand is CHEMBL212368. Check out the elaboration below.
| ok (Given Ligand) | CHEMBL212368 (Similar Ligand) |
|---|---|
| COc4ccc(c3cc1nccn1c(Nc2ccccc2C(N)=O)n3)cc4OC | CN(C)c1nnc(c2ccc(cc2)c3ccccc3)n1c4cccc(O)c4 |
|
|
|
|
|
|
| 0000a20a 40800808 a0080108 08850600 01001044 0001c000 0204a000 00081800 00c00100 00000840 01208004 60009800 8600c832 00100000 01060041 080c800c 08060040 12006000 0cc90008 10a23200 40000000 4c02a640 b1806840 0040010c 00000000 80000000 00028000 000110e0 0000c20c 00461808 c0041800 400000a2 | 0000e006 80000008 e0000100 00010600 01000040 00000004 23800000 00081000 00000100 10000840 38208104 40009818 06000802 00100203 00070040 000c600c 08028000 02006004 04400000 10260400 40100000 0800a000 31800000 00404000 00040000 c0000040 30100000 00000060 0001400c 00463000 80040b80 10200080 |