On Target MK03_HUMAN 0.38636363/CHEMBL3544964
For the given ligand ok, we have found in our database that, being scored 0.38636363, the most similar ligand is CHEMBL3544964. Check out the elaboration below.
| ok (Given Ligand) | CHEMBL3544964 (Similar Ligand) |
|---|---|
| COc4ccc(c3cc1nccn1c(Nc2ccccc2C(N)=O)n3)cc4OC | Cn1nccc1Nc2nccc(n2)C3=CC(=O)N(C=C3)[C@H](CO)c4ccc(Cl)c(F)c4 |
|
|
|
|
|
|
| 0000a20a 40800808 a0080108 08850600 01001044 0001c000 0204a000 00081800 00c00100 00000840 01208004 60009800 8600c832 00100000 01060041 080c800c 08060040 12006000 0cc90008 10a23200 40000000 4c02a640 b1806840 0040010c 00000000 80000000 00028000 000110e0 0000c20c 00461808 c0041800 400000a2 | 00008007 00200a08 a0104108 02050600 010c0044 00006050 00802000 00001000 06100302 500828f1 0c300004 70018800 82008864 00701000 00160000 001c460c 08060000 12806000 00600000 30a20000 40000000 1c03a110 33802840 87700118 00002000 c0001001 a0050020 100500f1 0540000c 0046880a 40040800 000206e2 |