On Target NMDZ1_HUMAN 0.35205993/CHEMBL163541
For the given ligand test, we have found in our database that, being scored 0.35205993, the most similar ligand is CHEMBL163541. Check out the elaboration below.
| test (Given Ligand) | CHEMBL163541 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | OC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1CN3CC(=O)N(C3=S)c4ccccc4 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 1001c006 09000800 00000122 14010e10 000c1020 0100c020 04004084 2a003001 00000b00 00090a68 01280004 4000a800 0600888e 0070a400 80020460 020c000c 0006c008 02c0280c 08200040 00000201 40160100 28078fe8 20822002 82400116 00146008 c0000400 08044000 a0000080 0b208104 00060001 c004c200 80434228 |