On Target PERM_HUMAN 0.2857143/CHEMBL2347034
For the given ligand test, we have found in our database that, being scored 0.2857143, the most similar ligand is CHEMBL2347034. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2347034 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | Fc1ccc2[nH]cc(CCCN3CCN(CC3)c4ccccc4)c2c1 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 00004002 00000a00 00100120 46810610 00041200 00000030 00002000 20000000 00400800 00080ac0 08300004 40008000 08000802 00403800 00000040 00040005 00040000 02000080 08200400 00100201 40100100 38008008 20800021 82400012 00042000 80000000 08000000 10000081 08008000 0007800a 00040200 00000620 |