On Target TRPV1_RAT 0.44339624/CHEMBL175383
For the given ligand test, we have found in our database that, being scored 0.44339624, the most similar ligand is CHEMBL175383. Check out the elaboration below.
| test (Given Ligand) | CHEMBL175383 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | Cc1cccnc1C2CCN(CC2)C(=O)Nc3ccc(cc3)C(F)(F)F |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 0000000e 01001a00 00104100 10010e10 00041020 00000000 00000424 20002001 00000800 000808d0 08388004 50818000 00009802 01308000 00020040 02040004 00040000 06400004 08200008 00000201 60000100 18058400 20826000 00500018 00150000 80000001 08000240 90000180 00408004 0086000b 00180000 20004600 |