On Target FABP5_HUMAN 0.25925925/CHEMBL3959018
For the given ligand test, we have found in our database that, being scored 0.25925925, the most similar ligand is CHEMBL3959018. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3959018 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | Clc1ccc2nc(N3CCCCC3)c(c4nnn[nH]4)c(c5ccccc5)c2c1 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 0000e002 01000819 40104100 00010e10 20041004 18062048 0400000c 00183000 00000100 200008d0 00218004 70018800 8300088e 00600000 20020040 000c200e 00060000 06004804 0c200000 00a00205 40160100 1c028108 30808800 8070c018 00042002 80680000 18040280 100010c0 0040c00c 00060800 80041200 09020220 |