On Target SC6A4_HUMAN 0.39647576/CHEMBL3818478
For the given ligand test, we have found in our database that, being scored 0.39647576, the most similar ligand is CHEMBL3818478. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3818478 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | O=C1NCN(c2ccccc2)C13CCN(CCCCc4c[nH]c5ccccc45)CC3 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 00024006 01000c00 00100122 40810e10 20041100 00000000 00002004 20002001 00700800 00080be0 08300004 5003b000 0c009802 00602800 00020040 00040004 00040000 02402000 08200400 00000a01 60100100 38018608 20820000 80500012 00152000 80000080 08000000 10000080 08008000 00060013 001c5200 00806620 |