On Target HYES_HUMAN 0.4039409/CHEMBL1818409
For the given ligand test, we have found in our database that, being scored 0.4039409, the most similar ligand is CHEMBL1818409. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1818409 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CC(CCc1ccccc1)NC(=O)Nc2cccc(c2F)C(F)(F)F |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 00000006 01001200 00100302 02010e00 04000000 00000010 00000404 00002001 00004800 000808d0 08380004 40008004 00009001 09301000 00000040 00040000 080c0600 02400000 08000000 00000011 40000100 18050400 20022000 00400018 00150000 80000000 00000000 90000081 00408000 0006800b 00180000 00004600 |