On Target TRPV3_HUMAN 0.31666666/CHEMBL3696385
For the given ligand test, we have found in our database that, being scored 0.31666666, the most similar ligand is CHEMBL3696385. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3696385 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CC(C)[C@H](CO)NCc1nc(ccc1F)C2CCc3ccccc3C2 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 0200009a 01000000 00104102 16010e00 000400a1 00100022 01000010 02003001 00000800 00080840 08318004 40808000 00000802 00201200 00820420 020e010d 12008200 060020a2 00602008 00100241 40000100 18118000 23c04000 20400010 00100800 c0000001 00000040 80001081 00000106 00860002 20040880 20004700 |