On Target AMPN_HUMAN 0.30147058/CHEMBL1828920
For the given ligand test, we have found in our database that, being scored 0.30147058, the most similar ligand is CHEMBL1828920. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1828920 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CC[C@H](C)[C@H](NC(=O)CC(C)(C)C)C(=O)N1Cc2cc(OCC(=O)NO)ccc2C[C@H]1C(=O)Nc3ccc(OC)cc3 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 0401c00a 45803218 60100128 14010602 20001020 00002000 03040000 2200100c 00000880 00090ac0 083c0004 4001f000 068088a2 00302081 810214c1 020c0018 10040200 820000a0 08080008 00120201 c0120100 38248600 22006003 8354801a 00000800 c0000001 00164008 90000080 0c008300 0086000f 20044000 00002600 |