On Target ADRB2_HUMAN 0.34538153/CHEMBL1814271
For the given ligand test, we have found in our database that, being scored 0.34538153, the most similar ligand is CHEMBL1814271. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1814271 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CC(=O)O.CC1(C)NC(=O)N(C1=O)c2cccc(CCCCOCCCCCCNC[C@H](O)c3ccc(O)c(CO)c3)c2 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 00014046 01003008 60100122 00010f00 24081081 00004000 02000004 20002809 00400980 00080ad0 a8380004 4001b000 04009002 08b02800 000a0040 00083008 10840000 02402000 08402000 40020201 44120120 38210e30 23022000 8150001a 00140400 80000000 00520000 10000080 0c408200 00060003 60004000 00006600 |