On Target ACM4_HUMAN 0.36888888/CHEMBL4065477
For the given ligand test, we have found in our database that, being scored 0.36888888, the most similar ligand is CHEMBL4065477. Check out the elaboration below.
| test (Given Ligand) | CHEMBL4065477 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | Fc1ccc2ncc(C#N)c(N3CCC(CC3)C(=O)Nc4cccnc4)c2c1 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 00024002 01800000 00104100 02010630 21041020 08002070 00008000 20000000 00200000 408108c0 00280004 50039000 04008802 00701000 00020041 00040007 00440000 0200000c 08a00000 00200205 40100000 18048608 20802500 82500010 00040002 80100000 08008400 10001081 00408000 00468401 00040000 008002c0 |