On Target NEP_HUMAN 0.30241936/CHEMBL301364
For the given ligand test, we have found in our database that, being scored 0.30241936, the most similar ligand is CHEMBL301364. Check out the elaboration below.
| test (Given Ligand) | CHEMBL301364 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | OC(=O)CCN1C(=O)[C@H](CCc2ccccc12)NC(=O)[C@@H](S)Cc3ccccc3 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 00014002 01003200 00100122 04110600 20000000 00002040 83000000 20000008 00100800 0b0f0ac0 08380024 5001b000 0e008002 00342000 80020040 000c000a 00248000 02000001 08800018 00000201 40100100 38140e00 21002081 0650001a 00001801 80000000 00000010 100010c0 08088000 0006000b 20004080 23412600 |