On Target ALDR_HUMAN 0.3562753/CHEMBL303779
For the given ligand test, we have found in our database that, being scored 0.3562753, the most similar ligand is CHEMBL303779. Check out the elaboration below.
| test (Given Ligand) | CHEMBL303779 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CN1C(=O)Nc2c(F)cccc2C13NC(=O)NC3=O |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 00010006 03803000 00100300 02010e00 00000000 40100012 00000004 0200300d 00004000 000a2840 0d280066 5000b000 0500b801 00103000 40020160 00000000 000cc418 03402024 08000010 008000c1 c0020500 38238600 20022000 81400018 00101004 80000201 80000010 80001081 0c209100 00068a03 20046001 e0004600 |