On Target NMDE2_HUMAN 0.374502/CHEMBL569802
For the given ligand test, we have found in our database that, being scored 0.374502, the most similar ligand is CHEMBL569802. Check out the elaboration below.
| test (Given Ligand) | CHEMBL569802 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | OC1c2cccc(C#N)c2C=Cc3ncc(cc13)N4CCCCC4 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 08084042 01804900 40104104 10410e30 20041021 08006010 80002480 09002408 04400100 008808d0 08200104 50018a00 00000802 00308000 80020003 020c000e 04450400 0200000c 08a00400 c0000205 44100000 18009460 20a04480 00510014 00040002 a3100001 08402441 50000280 02420084 00460403 c4000000 00002680 |