On Target GRM5_HUMAN 0.36524823/CHEMBL3600423
For the given ligand test, we have found in our database that, being scored 0.36524823, the most similar ligand is CHEMBL3600423. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3600423 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CCC[C@@H](NC(=O)c1occn1)c2cnc(Nc3ccc(C)nc3)c(Cl)c2 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 10018002 0d83d800 00184182 d0800eb0 24041120 08100000 00006410 2a403001 02406900 000a00d9 01390014 40007810 06008c0a 00308808 80020c20 020c0104 00068000 1200500e 0820040a 50a00205 c0000100 1c058f00 20804800 04740418 00940802 e1000602 0e1004c0 98010080 0040819c 00460803 40040000 80420680 |