On Target DRD3_HUMAN 0.4801762/CHEMBL3818935
For the given ligand test, we have found in our database that, being scored 0.4801762, the most similar ligand is CHEMBL3818935. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3818935 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | O=C1NCN(c2ccccc2)C13CCN(CCCCc4oc5ccccc5n4)CC3 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 0042400e 01000400 80180020 10000e40 20040220 00000008 01000404 20002201 00284120 00020bf0 00208004 5083b900 44089402 01602000 00020060 02040004 00044000 44402000 08200088 40000a01 60300500 38010600 20824000 04180012 00110000 00000281 04000014 18040080 0800a004 01860011 001c5000 60806200 |