On Target AGTR2_HUMAN 0.33887044/CHEMBL305647
For the given ligand test, we have found in our database that, being scored 0.33887044, the most similar ligand is CHEMBL305647. Check out the elaboration below.
| test (Given Ligand) | CHEMBL305647 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CCCC1=Nc2ccc(NC(=O)NC(C)C)cc2C(=O)N1Cc3ccc(cc3F)c4ccccc4S(=O)(=O)NC(=O)c5ccc(CC)cc5F |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 0000201e 00800a01 01181100 53b10e00 000c0020 00004038 04001805 00803001 86100108 500838e0 0938a00c 70818800 800b9840 03f01001 803300c0 020c0004 02062280 0650c008 0c680008 10016005 c0000100 1803c638 3182a041 8970041c 02102005 c0000084 e0000000 000400cd 0400c404 20c6804b c02c5000 600147e0 |