On Target OPRM_MOUSE 0.3580247/CHEMBL185687
For the given ligand test, we have found in our database that, being scored 0.3580247, the most similar ligand is CHEMBL185687. Check out the elaboration below.
| test (Given Ligand) | CHEMBL185687 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CCNC(=O)c1ccc(cc1)C(=C2CC3CCC(C2)N3Cc4ccccn4)c5cccc(NC(=O)C)c5 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 08004002 09000800 40104300 50010e00 04040024 00100010 80080080 23003401 00400100 001808d8 08290004 50018800 80028802 00100000 00020442 02040104 00040400 02000042 08202000 00000203 45100000 18038610 2080a020 0050001c 01140000 e0000000 00406040 d0001080 00408184 00060c03 a4060000 00006600 |