On Target P2Y12_HUMAN 0.33214286/CHEMBL1784191
For the given ligand test, we have found in our database that, being scored 0.33214286, the most similar ligand is CHEMBL1784191. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1784191 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CCOC(=O)c1cc(C#N)c(nc1C(F)(F)F)N2CCN(CC2)C(=O)Nc3cccc(c3)C#N |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 00004006 00802800 001041a4 94490e10 050c1030 0000c040 10100404 00002009 10200100 20830a70 04282004 40828800 0000a802 0931a000 00120940 1e1c000c 00660014 02404004 08e14000 40a00000 c4100101 2e05ae40 20822d21 0260080e 00140400 c0002000 080805c0 90001090 0c40821d 00060c01 c0101004 00004200 |