On Target CXCR1_HUMAN 0.36654803/CHEMBL430116
For the given ligand test, we have found in our database that, being scored 0.36654803, the most similar ligand is CHEMBL430116. Check out the elaboration below.
| test (Given Ligand) | CHEMBL430116 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CCC(NC1=C(Nc2cccc(C(=O)N(C)C)c2O)C(=O)C1=O)c3occn3 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 1041400a 00000808 e0180102 10012ec0 26000001 68122008 020004a0 22413501 05a04540 001208d0 00298014 5002b800 0e008c0a 00200008 80022060 1004614c 00050001 26008002 08230218 66020201 48100880 18138600 20004000 04508014 04941000 80000283 24500010 980c05c0 20508106 a0860001 84045420 60002200 |