On Target PGH2_HUMAN 0.3561644/CHEMBL4096865
For the given ligand test, we have found in our database that, being scored 0.3561644, the most similar ligand is CHEMBL4096865. Check out the elaboration below.
| test (Given Ligand) | CHEMBL4096865 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | Cc1ccc(NC(=O)c2c(N=Cc3cccnc3)c(C#N)c4CCCn24)cc1 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 0000400e 00a4da80 00104104 5c010e30 04061068 00110002 10048000 02001401 30500900 008908d1 0039802c 4081c810 90009800 48308800 000208c0 0a0c010c 08448810 86c0006c 48a00008 00000041 c0100101 1845a610 29816581 0250041c 013d0011 c0000001 48000410 90001082 0048810c 00c6084b c4080280 6000c6e0 |