On Target ACE_HUMAN 0.3379791/CHEMBL1242210
For the given ligand test, we have found in our database that, being scored 0.3379791, the most similar ligand is CHEMBL1242210. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1242210 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CN(Cc1nc2cccc(N3CCN(C)CC3)n2c1CO)[C@H]4CCCc5cccnc45 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 1001400a 01005800 001041a2 1c800e10 01041160 00104000 0100e000 2a003803 00500b00 200c02c0 4931a004 40815800 04000882 00b02800 00060c40 021c010c 0806aa00 07804006 88202408 40a00201 40120100 7e01a820 21804822 02700116 00140000 c1000401 0800c0c0 90000080 0840811e 00c63802 e0041100 a0004680 |