On Target CNR2_HUMAN 0.4082397/CHEMBL514543
For the given ligand test, we have found in our database that, being scored 0.4082397, the most similar ligand is CHEMBL514543. Check out the elaboration below.
| test (Given Ligand) | CHEMBL514543 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | Fc1ccc(c(Cl)c1)c2noc(n2)C3CCN(CC3)c4cnc5CCCCc5c4 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 0000c00a 01804820 40184103 56810630 25061120 18102010 21002828 68080041 00400920 000808d5 0831e004 50818880 02200806 00309884 00020041 020c0006 00068200 0600200c 08202408 00100205 64b00d00 18008100 30844200 00500030 00042002 81100201 08000468 10401181 01400026 00e68002 08000a80 60020688 |