On Target NTRK1_HUMAN 0.4090909/CHEMBL3962283
For the given ligand test, we have found in our database that, being scored 0.4090909, the most similar ligand is CHEMBL3962283. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3962283 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CCc1ncc(cc1NC(=O)Cc2ccc(cc2)C(F)(F)F)C(=O)C3CC([C@@H](C)CO)c4ncncc34 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 0001c00a 01804800 40504102 50850630 240c1120 08004052 01003410 00000001 00400900 40080850 28388024 40819800 0f008888 01b01800 40020081 120c000e 00048000 0600000c 08602408 40000005 c4100500 18348600 21c060c0 8940011d 00042002 80100301 08000550 90001080 24480006 00460003 c0122000 20c007a0 |