On Target CAH2_HUMAN 0.3275862/CHEMBL2047845
For the given ligand test, we have found in our database that, being scored 0.3275862, the most similar ligand is CHEMBL2047845. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2047845 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | NS(=O)(=O)Oc1ccc(NC(=O)NCCc2ccccn2)cc1 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 0800000e 40021008 20104320 10600e00 20040020 00000000 82000004 0000240d 00000000 00880a40 0828a004 40808000 00009822 00100003 01020040 2204800c 04040008 0a400000 08a00000 00020000 40000100 18218400 20822000 81400019 00111000 80000000 00040040 00000080 04008004 00060403 00000002 20014620 |