On Target CDK5_HUMAN 0.34351146/CHEMBL1516890
For the given ligand test, we have found in our database that, being scored 0.34351146, the most similar ligand is CHEMBL1516890. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1516890 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | Cn1cc(C=C2C(=O)Nc3cccnc23)c4ccccc14 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 0000420a 00808800 00114120 12010e30 20041024 0c000000 80000280 08020408 01800000 40482ac0 08288104 60819008 01018800 00710000 c1020143 02440044 20040400 8a800108 0823a000 00800006 40100000 1a028618 20822000 81410010 00041002 82100281 08402450 40011280 04400004 00460003 04047200 200026a0 |