On Target MIF_HUMAN 0.28444445/CHEMBL1604170
For the given ligand test, we have found in our database that, being scored 0.28444445, the most similar ligand is CHEMBL1604170. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1604170 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | OC(=O)c1cccc(NC(=S)NC(=O)c2ccc(cc2)c3ccccc3)c1 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 00002006 00000800 00000100 40010e00 00000000 00004000 00000004 22003001 00000100 00000850 01200004 40008000 80008800 08000000 00000060 10080008 00064000 02400800 0c000000 90000a01 40040100 08038e20 30020000 00400014 00140008 80000000 00000000 a00000c0 2162c100 00060001 c0040000 88014208 |