On Target IKKB_HUMAN 0.352459/CHEMBL260092
For the given ligand test, we have found in our database that, being scored 0.352459, the most similar ligand is CHEMBL260092. Check out the elaboration below.
| test (Given Ligand) | CHEMBL260092 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | Nc1ncnc2NCCC(=Nc12)c3ccc(NC(=O)Nc4cccc(c4)C(F)(F)F)cc3 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 00010006 00040a00 00180100 48091e60 24800000 80006004 10008400 00102801 00000900 000a08d1 0a390004 40009014 04008000 09108800 04060040 080c0004 00041808 02004000 08400000 80200211 40100100 18442400 20826040 00401810 001c0000 a0110002 40000400 98000080 00408808 0046000b 40101001 000046c0 |