On Target MK03_HUMAN 0.30041152/CHEMBL1336
For the given ligand test, we have found in our database that, being scored 0.30041152, the most similar ligand is CHEMBL1336. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1336 (Similar Ligand) |
|---|---|
| CC2(C)C(=O)N(c1ccc(C#N)c(C(F)(F)F)c1F)C(=S)N2c4ccc(CCCc3ncco3)nc4 | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(c3)C(F)(F)F)cc2)ccn1 |
|
|
|
|
|
|
| 0041400e 01800804 c0184322 52010e60 34040020 09000038 01000434 20002001 00004d00 008a2a50 08388004 5180b824 04009c01 0930b000 00020063 02040004 084c0600 06402808 88a00008 41000a15 441c0500 38018600 60826480 04500012 0115000a 81100381 04000440 98040081 08608004 00c68403 0c145000 68014688 | 00008006 44000808 20104108 10010e40 04041020 00100000 02000400 02003009 00000000 00000850 00290004 40008804 02008826 09100000 01024041 2204010c 00040000 02000004 08282000 00060010 40402100 08028700 20822000 00448004 00142000 80000200 000c0040 90200080 00408384 00060001 80140400 02264200 |