On Target NMDZ1_HUMAN 0.34532374/CHEMBL354003
For the given ligand DS-245, we have found in our database that, being scored 0.34532374, the most similar ligand is CHEMBL354003. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL354003 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | OC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1CN3CC(=O)N(C4CCCCC4)C3=O |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 10018002 09803800 00100100 14010e10 000c1020 0000c020 04004084 2a003008 00000300 000908c8 01280004 4001a800 0600988e 0070a400 800204c0 020c000c 0006c008 0280200c 02202040 00000201 c0020100 38078ff8 20802003 8250011c 00056000 c0000400 08044000 90000000 08000104 00060001 e00cc200 80420220 |