On Target PERM_HUMAN 0.27004218/CHEMBL86
For the given ligand DS-245, we have found in our database that, being scored 0.27004218, the most similar ligand is CHEMBL86. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL86 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 00008002 88002808 20000108 84010600 00001000 00020100 06000000 02001408 00000000 00110848 08200004 40008800 02008806 08002000 81000441 00002008 00000000 02000400 00000000 00020400 40000000 28028700 20000000 0240000c 00002000 c0000400 00100800 80000000 08000300 00060801 84040000 00020200 |