On Target PDE5A_HUMAN 0.4311594/CHEMBL1650876
For the given ligand DS-245, we have found in our database that, being scored 0.4311594, the most similar ligand is CHEMBL1650876. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL1650876 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | CCCCN1CC(=O)N2[C@H](Cc3c([nH]c4ccccc34)[C@H]2c5ccc(Cl)cc5Cl)C1=O |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 0001800a 0080fa00 00100100 55810e10 00041220 00180022 01002400 2300300d 00400880 001908c0 08318004 4080b800 1e0088e6 0060ac01 810204c0 02040184 00000200 02000027 00300408 00000a01 c0020d00 38278708 20804021 93400018 00543800 e0000201 08044000 d0000180 0e000184 0086000b 2c044200 20026620 |