On Target COMT_HUMAN 0.31152648/CHEMBL3819488
For the given ligand DS-245, we have found in our database that, being scored 0.31152648, the most similar ligand is CHEMBL3819488. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL3819488 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | CN(Cc1ccc(cc1)C(=O)c2cc(O)c(O)c(c2)[N+](=O)[O-])C(=O)CCCCCNC(=O)C[C@H](NC(=O)c3ccc(cc3)N=[N+]=[N-])C(=O)NCCCOCCOCCOCCCNC(=O)CCCC[C@@H]4SC[C@@H]5NC(=O)N[C@H]45 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 08038002 c7803c18 20101101 c4110e40 00004000 00000000 02002004 23003048 14602300 020949e0 0c200004 4007b800 8e019a0e 000c2100 20100541 300ac018 04209000 02802001 00802070 00020701 c4020120 381f8610 25000393 0a72141c 00851403 e0000000 80124000 d000a020 88500382 00060033 a00e4000 27812600 |