On Target TRPV1_RAT 0.3492647/CHEMBL438345
For the given ligand DS-245, we have found in our database that, being scored 0.3492647, the most similar ligand is CHEMBL438345. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL438345 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | Cn1c2CCCC(CNC(=O)c3ccc(OC(F)(F)F)cc3)c2c4cc(O)ccc14 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 0000000a 01005808 2010110b 51810610 00045130 00000002 07042000 22001105 00400880 000908c0 08308004 40c18000 18008806 00608800 01020441 0a04000c 00000200 86800004 00202408 00020201 40100100 18268618 20804009 9150041c 00042000 c0000001 08320000 d0000080 06000306 00860043 a0040200 20000620 |