On Target PAR1_HUMAN 0.37171054/CHEMBL68372
For the given ligand DS-245, we have found in our database that, being scored 0.37171054, the most similar ligand is CHEMBL68372. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL68372 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | NCC[C@H](NC(=O)[C@H](Cc1ccc(F)c(F)c1)NC(=O)Nc2ccc3c(CN4CCCC4)cn(Cc5c(Cl)cccc5Cl)c3c2)C(=O)NCc6cccs6 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 10038006 00803e00 02100100 06010e10 10041000 00000030 0000c084 2200700f 00300800 000b29c0 09380204 5003b880 0600b836 00503421 800024c0 00040004 00061818 82c0008c 08200008 00100209 c0001900 782d8f98 20826007 83500038 02156800 c4010200 88008080 90000085 0c708300 0006801b 200cc200 80c36660 |