On Target SC6A4_HUMAN 0.4329897/CHEMBL3128180
For the given ligand DS-245, we have found in our database that, being scored 0.4329897, the most similar ligand is CHEMBL3128180. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL3128180 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | Cc1nc2[C@@H](CCc2s1)C(=O)Nc3ccc(C[C@@H]4CC[C@@H](N4)[C@H](O)c5cccnc5)cc3 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 00034002 01004900 00504902 53890614 280c11a0 00026010 035020c0 18118009 00500980 00492ad0 08388a04 50819020 04008812 01b09801 014a2040 002c000c 10248200 0e000084 08602418 80004201 44100900 18a886d0 23806000 d1510015 02041000 8e000500 08200800 10001184 04428006 04061003 c8027080 20412610 |