On Target PPARG_HUMAN 0.362776/CHEMBL1778840
For the given ligand DS-245, we have found in our database that, being scored 0.362776, the most similar ligand is CHEMBL1778840. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL1778840 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | CC(C)c1nc(sc1CCc2noc3cc(OC(C)(C)C(=O)O)c(C)cc23)c4ccc(cc4)C(F)(F)F |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 04020082 01000108 201a0908 32814214 08041201 10120012 06402480 2c1bc049 044b0910 10480851 08148a20 5000da20 00809012 01601a41 03e22001 200c200c 11008200 8603e086 08202010 80c24201 05802900 08990a88 25e04000 58490090 12041000 8c010401 00200939 98801205 0022030c 05269202 08100800 e2010710 |