On Target PDE4B_HUMAN 0.4139073/CHEMBL3288016
For the given ligand DS-245, we have found in our database that, being scored 0.4139073, the most similar ligand is CHEMBL3288016. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL3288016 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | C[C@@H]1CN(Cc2ccc(cc2)c3cccc(Oc4ncc(F)cc4C(=O)N[C@@H]5CC[C@@H](CC5)NC(=O)c6nc(C)cs6)c3)C[C@H](C)N1 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 10022082 41809818 22104908 16010e10 80041000 00120122 06004480 2241f40b 00200104 001128d0 09290a04 50038000 81008892 00103021 21422521 0014210d 11021040 020030a6 06282010 10421201 c5421000 b8058e90 30803021 12d1011c 02141000 cc000001 08200810 90201045 084043a4 04061001 a5061c00 84012200 |