On Target HPGDS_HUMAN 0.32575756/CHEMBL3650217
For the given ligand DS-245, we have found in our database that, being scored 0.32575756, the most similar ligand is CHEMBL3650217. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL3650217 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | O=C(Nc1ccc(cc1)N2CCC(CC2)C(=O)N3CCOCC3)N4CCN(CC4)C(=O)c5cccs5 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 00034046 01007800 02100100 84000e00 20000080 00002000 00000084 2200700d 00200000 000308c0 00280204 50039080 0400a812 00102020 000a3448 00080108 11051010 0240000c 08200000 00000209 40101100 78058680 32022020 1250001c 02100400 44000000 00800000 90000085 08008300 00060001 80000000 00c14200 |