On Target NOS1_HUMAN 0.34042552/CHEMBL489724
For the given ligand DS-245, we have found in our database that, being scored 0.34042552, the most similar ligand is CHEMBL489724. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL489724 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | Cc1ncsc1C(=O)N(CC2=CC(=O)Nc3c(F)c(F)ccc23)c4cccc(Cl)c4 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 1002c002 00800800 00104902 17010618 00040000 00008070 08404080 0200d008 06000000 40200860 04280a04 5000c800 82008806 00701021 00122440 00040004 01063008 02002184 08200010 84184200 d0121000 08088f88 20812000 f0510008 03047000 cc000002 00304020 80000897 08048104 04078001 80048820 80030220 |