On Target OPRK_HUMAN 0.41735536/CHEMBL1412078
For the given ligand DS-245, we have found in our database that, being scored 0.41735536, the most similar ligand is CHEMBL1412078. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL1412078 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | CCC(C)(N(Cc1cccs1)C(=O)c2ccccn2)C(=O)NC3CCCCC3 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 00018002 01803800 02104100 14000e00 10048020 00100000 00000080 2200700f 00000000 000100c0 00290204 40013080 06008812 00102020 00022400 02040104 00003000 0200000e 02202000 00000209 c0001000 78078690 20802001 0250001c 02100000 c4010000 00300040 90000004 08000304 00060001 a0044000 00c16200 |