On Target ACM1_HUMAN 0.36585367/CHEMBL2206597
For the given ligand DS-245, we have found in our database that, being scored 0.36585367, the most similar ligand is CHEMBL2206597. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL2206597 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | CC(C)OC(=O)c1ccc(NC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)NCc3c[n+]4c(C)csc4n3Cc5ccc(Cl)cc5)cc1 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 10038016 21803a08 20100900 94090e10 00080050 00114000 0200c104 2800b80d 90800900 080b18d0 49398a0c d003b800 0600b866 0011a001 000a24c0 020c080c 38060018 02400082 88480018 c0830a01 c0000101 b8a38fa0 210221c0 8341011c 0015bc00 cd00ac00 083f8400 90000084 0c048205 044e080b e00c4004 80834688 |