On Target PGH1_SHEEP 0.3229572/CHEMBL9191
For the given ligand DS-245, we have found in our database that, being scored 0.3229572, the most similar ligand is CHEMBL9191. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL9191 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | C[C@]1(CCC(=O)NC1=O)N2C(=O)c3cccc(c3C2=O)[N+](=O)[O-] |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 10038002 01803810 00502102 14010600 00000000 00118000 00000880 22001008 16a00000 000308e0 04200004 5003b000 06018892 00202000 20120540 10000010 00002000 02000002 00100000 00000201 c0020000 38068680 20000001 0250041c 00040000 c0200000 00004008 90002000 88400100 00060001 a0444000 64802202 |