On Target NMDE2_HUMAN 0.25409836/CHEMBL444384
For the given ligand DS-245, we have found in our database that, being scored 0.25409836, the most similar ligand is CHEMBL444384. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL444384 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | O=C(CN1CCC(Cc2ccccc2)CC1)c3c[nH]c4ccccc34 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 00000002 01801800 00100102 41010610 00041000 00000000 00002000 20000004 00500880 000908c0 08300004 5001a000 12008802 00600000 80000040 00040004 00000000 02000000 00200400 00000201 c0000100 18228208 20800000 9150001c 00042000 80000000 08000000 10000000 04000000 00060002 80044200 00002620 |