On Target GLRA3_HUMAN 0.2647975/CHEMBL4070615
For the given ligand DS-245, we have found in our database that, being scored 0.2647975, the most similar ligand is CHEMBL4070615. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL4070615 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | C[C@H]1[C@@H]2[C@H](CN1S(=O)(=O)c3ccc4OCOc4c3)c5cnccc5N(C)C2=O |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 00020052 23804608 2110410a 01b00610 200c1700 00042050 0301a000 20040000 00600880 004909e0 40382034 60039000 0c00c803 10300801 81e20201 0024800e 000ce004 02000004 00680c18 00027e03 e0140300 18248600 20804000 99410018 42041800 0108000c 08828010 3000108c 05480600 20060a1b 00000080 20812670 |