On Target OPRD_HUMAN 0.4/CHEMBL605735
For the given ligand DS-245, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL605735. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL605735 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | CCN(CC)C(=O)c1ccc(cc1)C2(CCCN(Cc3nccs3)C2)c4cccc(O)c4 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 00020002 43000808 22100102 50010e00 00000000 c0100000 02000080 2301f00b 00100980 000808c0 08310a00 50018800 80008892 00200020 00022400 0004010c 00001000 02000086 00200010 00020201 00001100 98238680 20000000 8153001c 02100000 ec000000 00000000 d0000004 04000384 00061003 80040000 00012600 |